What is the molecular formula of ethylhexyl epoxytallate?
The molecular formula of ethylhexyl epoxytallate is C22H26O11.
What is the molecular weight of ethylhexyl epoxytallate?
The molecular weight of ethylhexyl epoxytallate is 466.4 g/mol.
What are the synonyms for ethylhexyl epoxytallate?
The synonyms for ethylhexyl epoxytallate are 2-Ethylhexyl epoxy tallate and (3,4,5-trihydroxybenzoyl)oxy 2-(2-ethylhexyl)-3,4,5-trihydroxybenzenecarboperoxoate.
What is the IUPAC name of ethylhexyl epoxytallate?
The IUPAC name of ethylhexyl epoxytallate is (3,4,5-trihydroxybenzoyl)oxy 2-(2-ethylhexyl)-3,4,5-trihydroxybenzenecarboperoxoate.
What is the InChI of ethylhexyl epoxytallate?
The InChI of ethylhexyl epoxytallate is InChI=1S/C22H26O11/c1-3-5-6-11(4-2)7-13-14(10-17(25)20(28)18(13)26)22(30)32-33-31-21(29)12-8-15(23)19(27)16(24)9-12/h8-11,23-28H,3-7H2,1-2H3.
What is the InChIKey of ethylhexyl epoxytallate?
The InChIKey of ethylhexyl epoxytallate is MUUNBNDLDHMVLD-UHFFFAOYSA-N.
How many hydrogen bond donor counts does ethylhexyl epoxytallate have?
Ethylhexyl epoxytallate has 6 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does ethylhexyl epoxytallate have?
Ethylhexyl epoxytallate has 11 hydrogen bond acceptor counts.
How many rotatable bond counts does ethylhexyl epoxytallate have?
Ethylhexyl epoxytallate has 12 rotatable bond counts.