What is the molecular formula of N,N-Diethylmethylamine?
The molecular formula of N,N-Diethylmethylamine is C5H13N.
What is the molecular weight of N,N-Diethylmethylamine?
The molecular weight of N,N-Diethylmethylamine is 87.16 g/mol.
What is the IUPAC Name of N,N-Diethylmethylamine?
The IUPAC Name of N,N-Diethylmethylamine is N-ethyl-N-methylethanamine.
What is the InChI of N,N-Diethylmethylamine?
The InChI of N,N-Diethylmethylamine is InChI=1S/C5H13N/c1-4-6(3)5-2/h4-5H2,1-3H3.
What is the InChIKey of N,N-Diethylmethylamine?
The InChIKey of N,N-Diethylmethylamine is GNVRJGIVDSQCOP-UHFFFAOYSA-N.
What is the CAS number of N,N-Diethylmethylamine?
The CAS number of N,N-Diethylmethylamine is 616-39-7.
What is the European Community (EC) Number of N,N-Diethylmethylamine?
The European Community (EC) Number of N,N-Diethylmethylamine is 210-480-5.
What is the UNII of N,N-Diethylmethylamine?
The UNII of N,N-Diethylmethylamine is 2Y6BJW3KUD.
What is the ChEMBL ID of N,N-Diethylmethylamine?
The ChEMBL ID of N,N-Diethylmethylamine is CHEMBL2448813.
Is N,N-Diethylmethylamine a canonicalized compound?
Yes, N,N-Diethylmethylamine is canonicalized according to PubChem.
Download
