What is the molecular formula of 1-Penten-3-ol?
The molecular formula of 1-Penten-3-ol is C5H10O.
What is the molecular weight of 1-Penten-3-ol?
The molecular weight of 1-Penten-3-ol is 86.13 g/mol.
Is 1-Penten-3-ol a natural product?
Yes, 1-Penten-3-ol is a natural product found in Cichorium endivia, Zingiber mioga, and other organisms.
What is the IUPAC name of 1-Penten-3-ol?
The IUPAC name of 1-Penten-3-ol is pent-1-en-3-ol.
What is the InChI of 1-Penten-3-ol?
The InChI of 1-Penten-3-ol is InChI=1S/C5H10O/c1-3-5(6)4-2/h3,5-6H,1,4H2,2H3.
What is the InChIKey of 1-Penten-3-ol?
The InChIKey of 1-Penten-3-ol is VHVMXWZXFBOANQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Penten-3-ol?
The canonical SMILES of 1-Penten-3-ol is CCC(C=C)O.
What is the CAS number of 1-Penten-3-ol?
The CAS number of 1-Penten-3-ol is 616-25-1.
What is the XLogP3-AA value of 1-Penten-3-ol?
The XLogP3-AA value of 1-Penten-3-ol is 1.1.
What is the hydrogen bond donor count of 1-Penten-3-ol?
The hydrogen bond donor count of 1-Penten-3-ol is 1.