What is the molecular formula of 2,5-Dimethylhydroquinone?
The molecular formula of 2,5-Dimethylhydroquinone is C8H10O2.
What are the synonyms for 2,5-Dimethylhydroquinone?
The synonyms for 2,5-Dimethylhydroquinone are 2,5-dimethylbenzene-1,4-diol and 1,4-Benzenediol, 2,5-dimethyl-.
What is the molecular weight of 2,5-Dimethylhydroquinone?
The molecular weight of 2,5-Dimethylhydroquinone is 138.16 g/mol.
When was 2,5-Dimethylhydroquinone created and modified?
2,5-Dimethylhydroquinone was created on 2005-03-26 and last modified on 2023-10-21.
What is the IUPAC name of 2,5-Dimethylhydroquinone?
The IUPAC name of 2,5-Dimethylhydroquinone is 2,5-dimethylbenzene-1,4-diol.
What is the InChI of 2,5-Dimethylhydroquinone?
The InChI of 2,5-Dimethylhydroquinone is InChI=1S/C8H10O2/c1-5-3-8(10)6(2)4-7(5)9/h3-4,9-10H,1-2H3.
What is the InChIKey of 2,5-Dimethylhydroquinone?
The InChIKey of 2,5-Dimethylhydroquinone is GPASWZHHWPVSRG-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dimethylhydroquinone?
The canonical SMILES of 2,5-Dimethylhydroquinone is CC1=CC(=C(C=C1O)C)O.
What is the CAS number of 2,5-Dimethylhydroquinone?
The CAS number of 2,5-Dimethylhydroquinone is 615-90-7.
What is the ChEMBL ID of 2,5-Dimethylhydroquinone?
The ChEMBL ID of 2,5-Dimethylhydroquinone is CHEMBL1795408.
Download
