What is the molecular formula of 2-Vinylanisole?
The molecular formula of 2-Vinylanisole is C9H10O.
What is the molecular weight of 2-Vinylanisole?
The molecular weight of 2-Vinylanisole is 134.17 g/mol.
What is the IUPAC name of 2-Vinylanisole?
The IUPAC name of 2-Vinylanisole is 1-ethenyl-2-methoxybenzene.
What is the InChI of 2-Vinylanisole?
The InChI of 2-Vinylanisole is InChI=1S/C9H10O/c1-3-8-6-4-5-7-9(8)10-2/h3-7H,1H2,2H3.
What is the InChIKey of 2-Vinylanisole?
The InChIKey of 2-Vinylanisole is SFBTTWXNCQVIEC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Vinylanisole?
The canonical SMILES of 2-Vinylanisole is COC1=CC=CC=C1C=C.
What is the CAS number of 2-Vinylanisole?
The CAS number of 2-Vinylanisole is 612-15-7.
What is the European Community (EC) number of 2-Vinylanisole?
The European Community (EC) number of 2-Vinylanisole is 210-294-4.
What is the XLogP3 value of 2-Vinylanisole?
The XLogP3 value of 2-Vinylanisole is 2.6.
What is the Topological Polar Surface Area of 2-Vinylanisole?
The Topological Polar Surface Area of 2-Vinylanisole is 9.2Ų.