What is the molecular formula of 2-Fluoropropionic acid?
The molecular formula of 2-Fluoropropionic acid is C3H5FO2.
What is the molecular weight of 2-Fluoropropionic acid?
The molecular weight of 2-Fluoropropionic acid is 92.07 g/mol.
What are some synonyms for 2-Fluoropropionic acid?
Some synonyms for 2-Fluoropropionic acid include 2-fluoropropanoic acid, 2-fluoropropionic acid, and MFCD06247714.
What is the IUPAC name of 2-Fluoropropionic acid?
The IUPAC name of 2-Fluoropropionic acid is 2-fluoropropanoic acid.
What is the InChI of 2-Fluoropropionic acid?
The InChI of 2-Fluoropropionic acid is InChI=1S/C3H5FO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6).
What is the InChIKey of 2-Fluoropropionic acid?
The InChIKey of 2-Fluoropropionic acid is ZVZPFTCEXIGSHM-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Fluoropropionic acid?
The Canonical SMILES of 2-Fluoropropionic acid is CC(C(=O)O)F.
What is the CAS number of 2-Fluoropropionic acid?
The CAS number of 2-Fluoropropionic acid is 6087-13-4.
What is the European Community (EC) number of 2-Fluoropropionic acid?
The European Community (EC) number of 2-Fluoropropionic acid is 633-145-9.
What is the topological polar surface area of 2-Fluoropropionic acid?
The topological polar surface area of 2-Fluoropropionic acid is 37.3Ų.