What is the molecular formula of Met-Leu-Phe acetate salt?
The molecular formula of Met-Leu-Phe acetate salt is C20H31N3O4S.
What is the molecular weight of Met-Leu-Phe acetate salt?
The molecular weight of Met-Leu-Phe acetate salt is 409.5 g/mol.
What is the IUPAC name of Met-Leu-Phe acetate salt?
The IUPAC name of Met-Leu-Phe acetate salt is 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
What is the InChI of Met-Leu-Phe acetate salt?
The InChI of Met-Leu-Phe acetate salt is InChI=1S/C20H31N3O4S/c1-13(2)11-16(22-18(24)15(21)9-10-28-3)19(25)23-17(20(26)27)12-14-7-5-4-6-8-14/h4-8,13,15-17H,9-12,21H2,1-3H3,(H,22,24)(H,23,25)(H,26,27).
What is the InChIKey of Met-Leu-Phe acetate salt?
The InChIKey of Met-Leu-Phe acetate salt is CHDYFPCQVUOJEB-UHFFFAOYSA-N.
What is the canonical SMILES of Met-Leu-Phe acetate salt?
The canonical SMILES of Met-Leu-Phe acetate salt is CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)O)NC(=O)C(CCSC)N.
What is the DSSTox Substance ID of Met-Leu-Phe acetate salt?
The DSSTox Substance ID of Met-Leu-Phe acetate salt is DTXSID20875277.
What is the Wikidata ID of Met-Leu-Phe acetate salt?
The Wikidata ID of Met-Leu-Phe acetate salt is Q27163320.
What is the XLogP3 value of Met-Leu-Phe acetate salt?
The XLogP3 value of Met-Leu-Phe acetate salt is -1.
What is the topological polar surface area of Met-Leu-Phe acetate salt?
The topological polar surface area of Met-Leu-Phe acetate salt is 147Ų.
Download
