What is the molecular formula of 2-Chloro-2-propen-1-ol?
The molecular formula of 2-Chloro-2-propen-1-ol is C3H5ClO.
What is the molecular weight of 2-Chloro-2-propen-1-ol?
The molecular weight of 2-Chloro-2-propen-1-ol is 92.52 g/mol.
What is the IUPAC name of 2-Chloro-2-propen-1-ol?
The IUPAC name of 2-Chloro-2-propen-1-ol is 2-chloroprop-2-en-1-ol.
What is the InChI of 2-Chloro-2-propen-1-ol?
The InChI of 2-Chloro-2-propen-1-ol is InChI=1S/C3H5ClO/c1-3(4)2-5/h5H,1-2H2.
What is the InChIKey of 2-Chloro-2-propen-1-ol?
The InChIKey of 2-Chloro-2-propen-1-ol is OSCXYTRISGREIM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-2-propen-1-ol?
The canonical SMILES of 2-Chloro-2-propen-1-ol is C=C(CO)Cl.
What is the CAS number of 2-Chloro-2-propen-1-ol?
The CAS number of 2-Chloro-2-propen-1-ol is 5976-47-6.
What is the UNII of 2-Chloro-2-propen-1-ol?
The UNII of 2-Chloro-2-propen-1-ol is V60IX5IR93.
What is the Nikkaji Number of 2-Chloro-2-propen-1-ol?
The Nikkaji Number of 2-Chloro-2-propen-1-ol is J51.039D.
Is 2-Chloro-2-propen-1-ol a canonicalized compound?
Yes, 2-Chloro-2-propen-1-ol is a canonicalized compound.