What is the molecular formula of 2-Bromo-5-methoxyaniline?
The molecular formula of 2-Bromo-5-methoxyaniline is C7H8BrNO.
What is the molecular weight of 2-Bromo-5-methoxyaniline?
The molecular weight of 2-Bromo-5-methoxyaniline is 202.05 g/mol.
What is the IUPAC name of 2-Bromo-5-methoxyaniline?
The IUPAC name of 2-Bromo-5-methoxyaniline is 2-bromo-5-methoxyaniline.
What is the InChI of 2-Bromo-5-methoxyaniline?
The InChI of 2-Bromo-5-methoxyaniline is InChI=1S/C7H8BrNO/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3.
What is the InChIKey of 2-Bromo-5-methoxyaniline?
The InChIKey of 2-Bromo-5-methoxyaniline is PRQDMSJEMCRFMI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-methoxyaniline?
The canonical SMILES of 2-Bromo-5-methoxyaniline is COC1=CC(=C(C=C1)Br)N.
What is the CAS number of 2-Bromo-5-methoxyaniline?
The CAS number of 2-Bromo-5-methoxyaniline is 59557-92-5.
What is the XLogP3 value of 2-Bromo-5-methoxyaniline?
The XLogP3 value of 2-Bromo-5-methoxyaniline is 1.9.
How many hydrogen bond donor counts does 2-Bromo-5-methoxyaniline have?
2-Bromo-5-methoxyaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromo-5-methoxyaniline have?
2-Bromo-5-methoxyaniline has 2 hydrogen bond acceptor counts.