What is the molecular formula of 3-Bromophenethylamine?
The molecular formula is C8H10BrN.
What is the molecular weight of 3-Bromophenethylamine?
The molecular weight is 200.08 g/mol.
What is the IUPAC name of 3-Bromophenethylamine?
The IUPAC name is 2-(3-bromophenyl)ethanamine.
What is the InChI of 3-Bromophenethylamine?
The InChI is InChI=1S/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2.
What is the InChIKey of 3-Bromophenethylamine?
The InChIKey is ORHRHMLEFQBHND-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromophenethylamine?
The canonical SMILES is C1=CC(=CC(=C1)Br)CCN.
What is the CAS number of 3-Bromophenethylamine?
The CAS number is 58971-11-2.
What is the European Community (EC) number of 3-Bromophenethylamine?
The European Community (EC) number is 629-414-5.
What is the UNII of 3-Bromophenethylamine?
The UNII is T535ZL7726.
What is the XLogP3-AA value of 3-Bromophenethylamine?
The XLogP3-AA value is 1.9.