What is the molecular formula of Dimethyl-3-bromophthalate?
The molecular formula of Dimethyl-3-bromophthalate is C10H9BrO4.
What are the synonyms of Dimethyl-3-bromophthalate?
The synonyms of Dimethyl-3-bromophthalate are DIMETHYL 3-BROMOPHTHALATE, 58749-33-0, dimethyl 3-bromobenzene-1,2-dicarboxylate, and DIMETHYL 3-BROMO-1,2-BENZENEDICARBOXYLATE.
What is the molecular weight of Dimethyl-3-bromophthalate?
The molecular weight of Dimethyl-3-bromophthalate is 273.08 g/mol.
When was Dimethyl-3-bromophthalate created and modified in PubChem?
Dimethyl-3-bromophthalate was created on 2011-10-30 and last modified on 2023-12-02 in PubChem.
What is the IUPAC name of Dimethyl-3-bromophthalate?
The IUPAC name of Dimethyl-3-bromophthalate is dimethyl 3-bromobenzene-1,2-dicarboxylate.
What is the InChI of Dimethyl-3-bromophthalate?
The InChI of Dimethyl-3-bromophthalate is InChI=1S/C10H9BrO4/c1-14-9(12)6-4-3-5-7(11)8(6)10(13)15-2/h3-5H,1-2H3.
What is the InChIKey of Dimethyl-3-bromophthalate?
The InChIKey of Dimethyl-3-bromophthalate is JRAPUXBKWPTMEQ-UHFFFAOYSA-N.
What is the canonical SMILES of Dimethyl-3-bromophthalate?
The canonical SMILES of Dimethyl-3-bromophthalate is COC(=O)C1=C(C(=CC=C1)Br)C(=O)OC.
What is the XLogP3 value of Dimethyl-3-bromophthalate?
The XLogP3 value of Dimethyl-3-bromophthalate is 2.3.
Is Dimethyl-3-bromophthalate a canonicalized compound?
Yes, Dimethyl-3-bromophthalate is a canonicalized compound.
※ Please kindly note that our products are for research use only.