What is the PubChem CID number for Sulforhodamine G?
The PubChem CID number for Sulforhodamine G is 23719921.
What is the molecular formula of Sulforhodamine G?
The molecular formula of Sulforhodamine G is C25H25N2NaO7S2.
What is the molecular weight of Sulforhodamine G?
The molecular weight of Sulforhodamine G is 552.6 g/mol.
What is the IUPAC name of Sulforhodamine G?
The IUPAC name of Sulforhodamine G is sodium;4-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]-3-sulfobenzenesulfonate.
What is the InChI key of Sulforhodamine G?
The InChI key of Sulforhodamine G is NWWFZBYHUXCUDI-UHFFFAOYSA-M.
What is the canonical SMILES of Sulforhodamine G?
The canonical SMILES of Sulforhodamine G is CCNC1=CC2=C(C=C1C)C(=C3C=C(C(=NCC)C=C3O2)C)C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)O.[Na+].
What is the CAS number of Sulforhodamine G?
The CAS number of Sulforhodamine G is 5873-16-5.
What is the EC number of Sulforhodamine G?
The EC number of Sulforhodamine G is 227-528-6.
What is the hydrogen bond donor count of Sulforhodamine G?
The hydrogen bond donor count of Sulforhodamine G is 2.
Is Sulforhodamine G a canonicalized compound?
Yes, Sulforhodamine G is a canonicalized compound according to PubChem.
What is the InChI of Sulforhodamine G?
The InChI of Sulforhodamine G is InChI=1S/C25H26N2O7S2.Na/c1-5-26-20-12-22-18(9-14(20)3)25(19-10-15(4)21(27-6-2)13-23(19)34-22)17-8-7-16(35(28,29)30)11-24(17)36(31,32)33;/h7-13,26H,5-6H2,1-4H3,(H,28,29,30)(H,31,32,33);/q;+1/p-1.
What is the InChIKey of Sulforhodamine G?
The InChIKey of Sulforhodamine G is NWWFZBYHUXCUDI-UHFFFAOYSA-M.
What is the European Community (EC) number of Sulforhodamine G?
The European Community (EC) number of Sulforhodamine G is 227-528-6.
Is Sulforhodamine G canonicalized?
Yes, Sulforhodamine G is canonicalized.
Download
