sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate;Acid Red 141;Red AR;5-[(2-Hydroxy-1-naphthalenyl)azo]-1-naphthalenesulfonic acid sodium salt;C.I.15625;C.I.Acid Red 141
What is the molecular formula of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The molecular formula is C20H13N2NaO4S.
What is the molecular weight of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The molecular weight is 400.4 g/mol.
What is the IUPAC name of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The IUPAC name is sodium;5-[(2-hydroxynaphthalen-1-yl)diazenyl]naphthalene-1-sulfonate.
What is the InChI of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The InChI is InChI=1S/C20H14N2O4S.Na/c23-18-12-11-13-5-1-2-6-14(13)20(18)22-21-17-9-3-8-16-15(17)7-4-10-19(16)27(24,25)26;/h1-12,23H,(H,24,25,26);/q;+1/p-1.
What is the InChIKey of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The InChIKey is XNQZZTFTKVKXOR-UHFFFAOYSA-M.
What is the canonical SMILES of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The canonical SMILES is C1=CC=C2C(=C1)C=CC(=C2N=NC3=CC=CC4=C3C=CC=C4S(=O)(=O)[O-])O.[Na+].
What is the CAS number of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The CAS number is 5850-93-1.
What is the molecular weight of sodium in the compound?
The molecular weight of sodium in the compound is not specified in the reference.
How many hydrogen bond donor counts are there in sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
There is 1 hydrogen bond donor count in the compound.
How many hydrogen bond acceptor counts are there in sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
There are 6 hydrogen bond acceptor counts in the compound.
What is the hydrogen bond donor count of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate?
The hydrogen bond acceptor count is 6.
Is sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate considered a canonicalized compound?
Yes, sodium 5-[(2-hydroxynaphthyl)azo]naphthalenesulphonate is considered a canonicalized compound.
※ Please kindly note that our products are for research use only.