What is the molecular formula of 2-Bromophenetole?
The molecular formula of 2-Bromophenetole is C8H9BrO.
What is the molecular weight of 2-Bromophenetole?
The molecular weight of 2-Bromophenetole is 201.06 g/mol.
What is the IUPAC name of 2-Bromophenetole?
The IUPAC name of 2-Bromophenetole is 1-bromo-2-ethoxybenzene.
What is the InChI of 2-Bromophenetole?
The InChI of 2-Bromophenetole is InChI=1S/C8H9BrO/c1-2-10-8-6-4-3-5-7(8)9/h3-6H,2H2,1H3.
What is the InChIKey of 2-Bromophenetole?
The InChIKey of 2-Bromophenetole is JVEQWIQHHWNMQX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromophenetole?
The canonical SMILES of 2-Bromophenetole is CCOC1=CC=CC=C1Br.
What is the CAS number of 2-Bromophenetole?
The CAS number of 2-Bromophenetole is 583-19-7.
What is the XLogP3 value of 2-Bromophenetole?
The XLogP3 value of 2-Bromophenetole is 3.2.
How many hydrogen bond donor counts does 2-Bromophenetole have?
2-Bromophenetole has 0 hydrogen bond donor counts.
How many rotatable bond counts does 2-Bromophenetole have?
2-Bromophenetole has 2 rotatable bond counts.