What is the molecular formula of Triphenylmethylamine?
The molecular formula of Triphenylmethylamine is C19H17N.
What is the IUPAC name of Triphenylmethylamine?
The IUPAC name of Triphenylmethylamine is triphenylmethanamine.
What is the InChI of Triphenylmethylamine?
The InChI of Triphenylmethylamine is InChI=1S/C19H17N/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,20H2.
What is the InChIKey of Triphenylmethylamine?
The InChIKey of Triphenylmethylamine is BZVJOYBTLHNRDW-UHFFFAOYSA-N.
What is the Canonical SMILES of Triphenylmethylamine?
The Canonical SMILES of Triphenylmethylamine is C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N.
What is the CAS number of Triphenylmethylamine?
The CAS number of Triphenylmethylamine is 5824-40-8.
What is the molecular weight of Triphenylmethylamine?
The molecular weight of Triphenylmethylamine is 259.3 g/mol.
How many hydrogen bond donor counts does Triphenylmethylamine have?
Triphenylmethylamine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Triphenylmethylamine have?
Triphenylmethylamine has 1 hydrogen bond acceptor count.
How many rotatable bond counts does Triphenylmethylamine have?
Triphenylmethylamine has 3 rotatable bond counts.