What is the PubChem CID of 2-Propyl-1-pentanol?
The PubChem CID of 2-Propyl-1-pentanol is 123543.
What is the molecular formula of 2-Propyl-1-pentanol?
The molecular formula of 2-Propyl-1-pentanol is C8H18O.
What is the molecular weight of 2-Propyl-1-pentanol?
The molecular weight of 2-Propyl-1-pentanol is 130.23 g/mol.
What is the IUPAC name of 2-Propyl-1-pentanol?
The IUPAC name of 2-Propyl-1-pentanol is 2-propylpentan-1-ol.
What is the InChI of 2-Propyl-1-pentanol?
The InChI of 2-Propyl-1-pentanol is InChI=1S/C8H18O/c1-3-5-8(7-9)6-4-2/h8-9H,3-7H2,1-2H3.
What is the InChIKey of 2-Propyl-1-pentanol?
The InChIKey of 2-Propyl-1-pentanol is LASHFHLFDRTERB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Propyl-1-pentanol?
The canonical SMILES of 2-Propyl-1-pentanol is CCCC(CCC)CO.
What is the CAS number of 2-Propyl-1-pentanol?
The CAS number of 2-Propyl-1-pentanol is 58175-57-8.
What is the XLogP3-AA value of 2-Propyl-1-pentanol?
The XLogP3-AA value of 2-Propyl-1-pentanol is 2.7.
Is 2-Propyl-1-pentanol a canonicalized compound?
Yes, 2-Propyl-1-pentanol is a canonicalized compound.