What is the molecular formula of 2,6-dimethylnaphthalene?
The molecular formula of 2,6-dimethylnaphthalene is C12H12.
What is the molecular weight of 2,6-dimethylnaphthalene?
The molecular weight of 2,6-dimethylnaphthalene is 156.22 g/mol.
What is the IUPAC name of 2,6-dimethylnaphthalene?
The IUPAC name of 2,6-dimethylnaphthalene is 2,6-dimethylnaphthalene.
What is the InChI of 2,6-dimethylnaphthalene?
The InChI of 2,6-dimethylnaphthalene is InChI=1S/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3.
What is the InChIKey of 2,6-dimethylnaphthalene?
The InChIKey of 2,6-dimethylnaphthalene is YGYNBBAUIYTWBF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-dimethylnaphthalene?
The canonical SMILES of 2,6-dimethylnaphthalene is CC1=CC2=C(C=C1)C=C(C=C2)C.
What is the CAS number of 2,6-dimethylnaphthalene?
The CAS number of 2,6-dimethylnaphthalene is 581-42-0.
What is the European Community (EC) number of 2,6-dimethylnaphthalene?
The European Community (EC) number of 2,6-dimethylnaphthalene is 209-464-0.
What is the ChEMBL ID of 2,6-dimethylnaphthalene?
The ChEMBL ID of 2,6-dimethylnaphthalene is CHEMBL194983.
What is the XLogP3 value of 2,6-dimethylnaphthalene?
The XLogP3 value of 2,6-dimethylnaphthalene is 4.3.