What is the molecular formula of 5-methyl-2-nitroaniline?
The molecular formula of 5-methyl-2-nitroaniline is C7H8N2O2.
What is the molecular weight of 5-methyl-2-nitroaniline?
The molecular weight of 5-methyl-2-nitroaniline is 152.15 g/mol.
What is the IUPAC name of 5-methyl-2-nitroaniline?
The IUPAC name of 5-methyl-2-nitroaniline is 5-methyl-2-nitroaniline.
What is the InChI of 5-methyl-2-nitroaniline?
The InChI of 5-methyl-2-nitroaniline is InChI=1S/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3.
What is the InChIKey of 5-methyl-2-nitroaniline?
The InChIKey of 5-methyl-2-nitroaniline is IGDYNWKWXUCIJB-UHFFFAOYSA-N.
What is the canonical SMILES of 5-methyl-2-nitroaniline?
The canonical SMILES of 5-methyl-2-nitroaniline is CC1=CC(=C(C=C1)[N+](=O)[O-])N.
What is the CAS number of 5-methyl-2-nitroaniline?
The CAS number of 5-methyl-2-nitroaniline is 578-46-1.
What is the UNII of 5-methyl-2-nitroaniline?
The UNII of 5-methyl-2-nitroaniline is YY17U389O6.
What is the ChEMBL ID of 5-methyl-2-nitroaniline?
The ChEMBL ID of 5-methyl-2-nitroaniline is CHEMBL278016.