What is the molecular formula of 2,3-Dibromophenol?
The molecular formula of 2,3-Dibromophenol is C6H4Br2O.
What is the molecular weight of 2,3-Dibromophenol?
The molecular weight of 2,3-Dibromophenol is 251.90 g/mol.
When was 2,3-Dibromophenol created and modified according to PubChem?
2,3-Dibromophenol was created on 2005-08-08 and last modified on 2023-12-02.
What is the IUPAC Name of 2,3-Dibromophenol?
The IUPAC Name of 2,3-Dibromophenol is 2,3-dibromophenol.
What is the InChI of 2,3-Dibromophenol?
The InChI of 2,3-Dibromophenol is InChI=1S/C6H4Br2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H.
What is the InChIKey of 2,3-Dibromophenol?
The InChIKey of 2,3-Dibromophenol is FNAKEOXYWBWIRT-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dibromophenol?
The canonical SMILES of 2,3-Dibromophenol is C1=CC(=C(C(=C1)Br)Br)O.
What is the CAS number of 2,3-Dibromophenol?
The CAS number of 2,3-Dibromophenol is 28514-45-6.
Is 2,3-Dibromophenol a canonicalized compound according to PubChem?
Yes, 2,3-Dibromophenol is a canonicalized compound according to PubChem.