What is the PubChem CID for 4-Bromo-1-naphthol?
The PubChem CID for 4-Bromo-1-naphthol is 575609.
What is the molecular formula of 4-Bromo-1-naphthol?
The molecular formula of 4-Bromo-1-naphthol is C10H7BrO.
What is the molecular weight of 4-Bromo-1-naphthol?
The molecular weight of 4-Bromo-1-naphthol is 223.07 g/mol.
What is the IUPAC name of 4-Bromo-1-naphthol?
The IUPAC name of 4-Bromo-1-naphthol is 4-bromonaphthalen-1-ol.
What is the InChI of 4-Bromo-1-naphthol?
The InChI of 4-Bromo-1-naphthol is InChI=1S/C10H7BrO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H.
What is the InChIKey of 4-Bromo-1-naphthol?
The InChIKey of 4-Bromo-1-naphthol is OUNQUWORSXHSJN-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromo-1-naphthol?
The Canonical SMILES of 4-Bromo-1-naphthol is C1=CC=C2C(=C1)C(=CC=C2Br)O.
What is the CAS number of 4-Bromo-1-naphthol?
The CAS number of 4-Bromo-1-naphthol is 571-57-3.
What is the XLogP3 value of 4-Bromo-1-naphthol?
The XLogP3 value of 4-Bromo-1-naphthol is 4.
Is 4-Bromo-1-naphthol considered as a canonicalized compound?
Yes, 4-Bromo-1-naphthol is considered as a canonicalized compound.