What is the molecular formula of Phencyclone?
The molecular formula of Phencyclone is C29H18O.
What is the molecular weight of Phencyclone?
The molecular weight of Phencyclone is 382.5 g/mol.
What is the IUPAC name of Phencyclone?
The IUPAC name of Phencyclone is 1,3-diphenylcyclopenta[l]phenanthren-2-one.
What is the InChI of Phencyclone?
The InChI of Phencyclone is InChI=1S/C29H18O/c30-29-25(19-11-3-1-4-12-19)27-23-17-9-7-15-21(23)22-16-8-10-18-24(22)28(27)26(29)20-13-5-2-6-14-20/h1-18H.
What is the InChIKey of Phencyclone?
The InChIKey of Phencyclone is MNSDGJFEKUKHGO-UHFFFAOYSA-N.
What is the CAS number of Phencyclone?
The CAS number of Phencyclone is 5660-91-3.
What is the UNII of Phencyclone?
The UNII of Phencyclone is JCN3BF3DH8.
How many hydrogen bond donor counts does Phencyclone have?
Phencyclone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Phencyclone have?
Phencyclone has 1 hydrogen bond acceptor count.
How many rotatable bond counts does Phencyclone have?
Phencyclone has 2 rotatable bond counts.