What is the molecular formula of tetrabutylammonium phosphate?
The molecular formula of tetrabutylammonium phosphate is C16H38NO4P.
What is the molecular weight of tetrabutylammonium phosphate?
The molecular weight of tetrabutylammonium phosphate is 339.45 g/mol.
What are the synonyms of tetrabutylammonium phosphate?
The synonyms of tetrabutylammonium phosphate are Tetrabutylammonium dihydrogen phosphate, tetrabutylammonium dihydrogenphosphate, and 1-Butanaminium, N,N,N-tributyl-, phosphate (1:1).
What is the IUPAC name of tetrabutylammonium phosphate?
The IUPAC name of tetrabutylammonium phosphate is dihydrogen phosphate;tetrabutylazanium.
What is the InChI of tetrabutylammonium phosphate?
The InChI of tetrabutylammonium phosphate is InChI=1S/C16H36N.H3O4P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H3,1,2,3,4)/q+1;/p-1.
What is the InChIKey of tetrabutylammonium phosphate?
The InChIKey of tetrabutylammonium phosphate is ARRNBPCNZJXHRJ-UHFFFAOYSA-M.
What is the canonical SMILES of tetrabutylammonium phosphate?
The canonical SMILES of tetrabutylammonium phosphate is CCCC[N+](CCCC)(CCCC)CCCC.OP(=O)(O)[O-].
What is the CAS number of tetrabutylammonium phosphate?
The CAS number of tetrabutylammonium phosphate is 5574-97-0.
What is the physical description of tetrabutylammonium phosphate?
Tetrabutylammonium phosphate is described as a white crystalline solid.
What is the hydrogen bond donor count of tetrabutylammonium phosphate?
The hydrogen bond donor count of tetrabutylammonium phosphate is 2.
※ Please kindly note that our products are for research use only.