What is the molecular formula of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The molecular formula is C9H16NO2.
What are the synonyms for 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The synonyms are [3-(hydroxymethyl)-2,2,5,5-tetramethyl-2,5-dihydro-1h-pyrrol-1-yl]oxidanyl, PCAOL, 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-1-oxyl, CHEMBL607183.
What is the molecular weight of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The molecular weight is 170.23 g/mol.
When was 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl created?
It was created on August 8, 2005.
When was 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl last modified?
It was last modified on October 21, 2023.
What is the InChI of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The InChI is InChI=1S/C9H16NO2/c1-8(2)5-7(6-11)9(3,4)10(8)12/h5,11H,6H2,1-4H3.
What is the InChIKey of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The InChIKey is NCMGONIKCPXQRB-UHFFFAOYSA-N.
What is the canonical SMILES of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The canonical SMILES is CC1(C=C(C(N1[O])(C)C)CO)C.
What is the CAS number of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The CAS number is 55738-75-5.
What is the XLogP3-AA value of 3-hydroxymethyl-2,2,5,5-tetramethylpyrroline-N-oxyl?
The XLogP3-AA value is -0.2.
※ Please kindly note that our products are for research use only.