What is the molecular formula of 2-Bromobenzimidazole?
The molecular formula of 2-Bromobenzimidazole is C7H5BrN2.
What is the molecular weight of 2-Bromobenzimidazole?
The molecular weight of 2-Bromobenzimidazole is 197.03 g/mol.
What is the IUPAC name of 2-Bromobenzimidazole?
The IUPAC name of 2-Bromobenzimidazole is 2-bromo-1H-benzimidazole.
What is the InChI of 2-Bromobenzimidazole?
The InChI of 2-Bromobenzimidazole is InChI=1S/C7H5BrN2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10).
What is the InChIKey of 2-Bromobenzimidazole?
The InChIKey of 2-Bromobenzimidazole is PHPYXVIHDRDPDI-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromobenzimidazole?
The canonical SMILES of 2-Bromobenzimidazole is C1=CC=C2C(=C1)NC(=N2)Br.
What is the CAS number of 2-Bromobenzimidazole?
The CAS number of 2-Bromobenzimidazole is 54624-57-6.
What is the European Community (EC) number of 2-Bromobenzimidazole?
The European Community (EC) number of 2-Bromobenzimidazole is 642-635-1.
What is the XLogP3 value of 2-Bromobenzimidazole?
The XLogP3 value of 2-Bromobenzimidazole is 2.3.
Is 2-Bromobenzimidazole a canonicalized compound?
Yes, 2-Bromobenzimidazole is a canonicalized compound.