What is the molecular formula of 3-Bromo-2-nitropyridine?
The molecular formula of 3-Bromo-2-nitropyridine is C5H3BrN2O2.
What is the molecular weight of 3-Bromo-2-nitropyridine?
The molecular weight of 3-Bromo-2-nitropyridine is 202.99 g/mol.
What is the IUPAC name of 3-Bromo-2-nitropyridine?
The IUPAC name of 3-Bromo-2-nitropyridine is 3-bromo-2-nitropyridine.
What is the InChI of 3-Bromo-2-nitropyridine?
The InChI of 3-Bromo-2-nitropyridine is InChI=1S/C5H3BrN2O2/c6-4-2-1-3-7-5(4)8(9)10/h1-3H.
What is the InChIKey of 3-Bromo-2-nitropyridine?
The InChIKey of 3-Bromo-2-nitropyridine is WFNISJZUJCKTLT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-nitropyridine?
The canonical SMILES of 3-Bromo-2-nitropyridine is C1=CC(=C(N=C1)[N+](=O)[O-])Br.
What is the CAS number of 3-Bromo-2-nitropyridine?
The CAS number of 3-Bromo-2-nitropyridine is 54231-33-3.
What is the European Community (EC) number of 3-Bromo-2-nitropyridine?
The European Community (EC) number of 3-Bromo-2-nitropyridine is 641-347-3.
What is the DSSTox Substance ID of 3-Bromo-2-nitropyridine?
The DSSTox Substance ID of 3-Bromo-2-nitropyridine is DTXSID20344034.
Is 3-Bromo-2-nitropyridine a canonicalized compound in PubChem?
Yes, 3-Bromo-2-nitropyridine is a canonicalized compound in PubChem.