What is the molecular formula of 2-Bromo-1-indanol?
The molecular formula of 2-Bromo-1-indanol is C9H9BrO.
What is the molecular weight of 2-Bromo-1-indanol?
The molecular weight of 2-Bromo-1-indanol is 213.07 g/mol.
What is the IUPAC name of 2-Bromo-1-indanol?
The IUPAC name of 2-Bromo-1-indanol is 2-bromo-2,3-dihydro-1H-inden-1-ol.
What is the InChI of 2-Bromo-1-indanol?
The InChI of 2-Bromo-1-indanol is InChI=1S/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2.
What is the InChIKey of 2-Bromo-1-indanol?
The InChIKey of 2-Bromo-1-indanol is RTESDSDXFLYAKZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-1-indanol?
The canonical SMILES of 2-Bromo-1-indanol is C1C(C(C2=CC=CC=C21)O)Br.
What is the CAS number of 2-Bromo-1-indanol?
The CAS number of 2-Bromo-1-indanol is 5400-80-6.
What is the European Community (EC) number of 2-Bromo-1-indanol?
The European Community (EC) number of 2-Bromo-1-indanol is 226-442-6.
What is the UNII of 2-Bromo-1-indanol?
The UNII of 2-Bromo-1-indanol is 4E68V72BZA.
Is 2-Bromo-1-indanol a canonicalized compound?
Yes, 2-Bromo-1-indanol is a canonicalized compound according to PubChem.