What is the PubChem CID of 7-Bromoindazole?
The PubChem CID of 7-Bromoindazole is 20323899.
What is the molecular formula of 7-Bromoindazole?
The molecular formula of 7-Bromoindazole is C7H5BrN2.
What is the molecular weight of 7-Bromoindazole?
The molecular weight of 7-Bromoindazole is 197.03 g/mol.
What is the IUPAC name of 7-Bromoindazole?
The IUPAC name of 7-Bromoindazole is 7-bromo-1H-indazole.
What is the InChI of 7-Bromoindazole?
The InChI of 7-Bromoindazole is InChI=1S/C7H5BrN2/c8-6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10).
What is the InChIKey of 7-Bromoindazole?
The InChIKey of 7-Bromoindazole is KMHHWCPTROQUFM-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromoindazole?
The canonical SMILES of 7-Bromoindazole is C1=CC2=C(C(=C1)Br)NN=C2.
What is the CAS number of 7-Bromoindazole?
The CAS number of 7-Bromoindazole is 53857-58-2.
What is the European Community (EC) number of 7-Bromoindazole?
The European Community (EC) number of 7-Bromoindazole is 640-934-1.
Is 7-Bromoindazole a canonicalized compound?
Yes, 7-Bromoindazole is a canonicalized compound.