What is the molecular formula of 4-Bromo-3-nitroanisole?
The molecular formula of 4-Bromo-3-nitroanisole is C7H6BrNO3.
What is the molecular weight of 4-Bromo-3-nitroanisole?
The molecular weight of 4-Bromo-3-nitroanisole is 232.03 g/mol.
What is the IUPAC name of 4-Bromo-3-nitroanisole?
The IUPAC name of 4-Bromo-3-nitroanisole is 1-bromo-4-methoxy-2-nitrobenzene.
What is the InChI of 4-Bromo-3-nitroanisole?
The InChI of 4-Bromo-3-nitroanisole is InChI=1S/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3.
What is the InChIKey of 4-Bromo-3-nitroanisole?
The InChIKey of 4-Bromo-3-nitroanisole is KCOBIBRGPCFIGF-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-nitroanisole?
The canonical SMILES of 4-Bromo-3-nitroanisole is COC1=CC(=C(C=C1)Br)[N+](=O)[O-].
What is the CAS number of 4-Bromo-3-nitroanisole?
The CAS number of 4-Bromo-3-nitroanisole is 5344-78-5.
What is the European Community (EC) number of 4-Bromo-3-nitroanisole?
The European Community (EC) number of 4-Bromo-3-nitroanisole is 226-290-0.
What is the Nikkaji Number of 4-Bromo-3-nitroanisole?
The Nikkaji Number of 4-Bromo-3-nitroanisole is J217.909A.
Is 4-Bromo-3-nitroanisole canonicalized?
Yes, 4-Bromo-3-nitroanisole is canonicalized.