What is the PubChem CID for 6-Bromobenzothiazole?
The PubChem CID for 6-Bromobenzothiazole is 2795171.
What is the molecular formula of 6-Bromobenzothiazole?
The molecular formula of 6-Bromobenzothiazole is C7H4BrNS.
What is the molecular weight of 6-Bromobenzothiazole?
The molecular weight of 6-Bromobenzothiazole is 214.08 g/mol.
What is the IUPAC name of 6-Bromobenzothiazole?
The IUPAC name of 6-Bromobenzothiazole is 6-bromo-1,3-benzothiazole.
What is the InChI code for 6-Bromobenzothiazole?
The InChI code for 6-Bromobenzothiazole is InChI=1S/C7H4BrNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H.
What is the InChIKey of 6-Bromobenzothiazole?
The InChIKey of 6-Bromobenzothiazole is YJOUISWKEOXIMC-UHFFFAOYSA-N.
What is the CAS number of 6-Bromobenzothiazole?
The CAS number of 6-Bromobenzothiazole is 53218-26-1.
What is the XLogP3 value of 6-Bromobenzothiazole?
The XLogP3 value of 6-Bromobenzothiazole is 2.7.
How many hydrogen bond acceptor count does 6-Bromobenzothiazole have?
6-Bromobenzothiazole has 2 hydrogen bond acceptor count.
Is 6-Bromobenzothiazole a canonicalized compound?
Yes, 6-Bromobenzothiazole is a canonicalized compound.