What is the molecular formula of 2-Bromo-5-methylaniline?
The molecular formula is C7H8BrN.
What is the molecular weight of 2-Bromo-5-methylaniline?
The molecular weight is 186.05 g/mol.
What is the IUPAC name of 2-Bromo-5-methylaniline?
The IUPAC name is 2-bromo-5-methylaniline.
What is the InChI of 2-Bromo-5-methylaniline?
The InChI is InChI=1S/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3.
What is the InChIKey of 2-Bromo-5-methylaniline?
The InChIKey is QTAQWOXSUFGGKH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-methylaniline?
The canonical SMILES is CC1=CC(=C(C=C1)Br)N.
What is the CAS number of 2-Bromo-5-methylaniline?
The CAS number is 53078-85-6.
What is the European Community (EC) number of 2-Bromo-5-methylaniline?
The EC number is 628-662-1.
What is the XLogP3 value of 2-Bromo-5-methylaniline?
The XLogP3 value is 2.
Is 2-Bromo-5-methylaniline a canonicalized compound?
Yes, 2-Bromo-5-methylaniline is a canonicalized compound.