What is the molecular formula of 3-Methylvaleryl chloride?
The molecular formula of 3-Methylvaleryl chloride is C6H11ClO.
What are the synonyms of 3-Methylvaleryl chloride?
The synonyms of 3-Methylvaleryl chloride are 3-Methylpentanoyl Chloride and 3-METHYLPENTANOYLCHLORIDE.
What is the molecular weight of 3-Methylvaleryl chloride?
The molecular weight of 3-Methylvaleryl chloride is 134.60 g/mol.
When was 3-Methylvaleryl chloride created?
3-Methylvaleryl chloride was created on February 8, 2007.
What is the IUPAC name of 3-Methylvaleryl chloride?
The IUPAC name of 3-Methylvaleryl chloride is 3-methylpentanoyl chloride.
What is the InChI of 3-Methylvaleryl chloride?
The InChI of 3-Methylvaleryl chloride is InChI=1S/C6H11ClO/c1-3-5(2)4-6(7)8/h5H,3-4H2,1-2H3.
What is the InChIKey of 3-Methylvaleryl chloride?
The InChIKey of 3-Methylvaleryl chloride is OGMHLZVDKIJTMN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methylvaleryl chloride?
The canonical SMILES of 3-Methylvaleryl chloride is CCC(C)CC(=O)Cl.
What is the CAS number of 3-Methylvaleryl chloride?
The CAS number of 3-Methylvaleryl chloride is 51116-72-4.
What is the XLogP3-AA value of 3-Methylvaleryl chloride?
The XLogP3-AA value of 3-Methylvaleryl chloride is 2.6.