What is the molecular formula of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The molecular formula is C18H21NO4.
What are the synonyms of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The synonyms are 500789-00-4, Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid, (R)-3-((tert-Butoxycarbonyl)amino)-3-(naphthalen-1-yl)propanoic acid, (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid.
When was Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid created?
It was created on July 29, 2006.
What is the molecular weight of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The molecular weight is 315.4 g/mol.
What is the IUPAC name of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The IUPAC name is (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid.
What is the InChI of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The InChI is InChI=1S/C18H21NO4/c1-18(2,3)23-17(22)19-15(11-16(20)21)14-10-6-8-12-7-4-5-9-13(12)14/h4-10,15H,11H2,1-3H3,(H,19,22)(H,20,21)/t15-/m1/s1.
What is the InChIKey of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The InChIKey is YDSAGJMVVUBPOK-OAHLLOKOSA-N.
What is the canonical SMILES of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The canonical SMILES is CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC2=CC=CC=C21.
What is the CAS identification number of Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid?
The CAS identification number is 500789-00-4.
How many hydrogen bond donors does Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid have?
It has 2 hydrogen bond donors.
※ Please kindly note that our products are for research use only.