What is the PubChem CID of hydrobenzoin?
PubChem CID 95447.
What is the molecular formula of hydrobenzoin?
The molecular formula of hydrobenzoin is C14H14O2.
What are some synonyms for hydrobenzoin?
Some synonyms for hydrobenzoin are 1,2-Diphenylethane-1,2-diol and (+/-)-Hydrobenzoin.
What is the molecular weight of hydrobenzoin?
The molecular weight of hydrobenzoin is 214.26 g/mol.
When was hydrobenzoin created and modified?
Hydrobenzoin was created on March 26, 2005, and last modified on December 2, 2023.
What is the IUPAC name of hydrobenzoin?
The IUPAC name of hydrobenzoin is 1,2-diphenylethane-1,2-diol.
What is the InChI of hydrobenzoin?
The InChI of hydrobenzoin is InChI=1S/C14H14O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-16H.
What is the InChIKey of hydrobenzoin?
The InChIKey of hydrobenzoin is IHPDTPWNFBQHEB-UHFFFAOYSA-N.
What is the canonical SMILES of hydrobenzoin?
The canonical SMILES of hydrobenzoin is C1=CC=C(C=C1)C(C(C2=CC=CC=C2)O)O.
What is the CAS number of hydrobenzoin?
The CAS number of hydrobenzoin is 492-70-6.
Download
