What is the molecular formula of Dichlorodiphenoxymethane?
The molecular formula of Dichlorodiphenoxymethane is C13H10Cl2O2.
What is the molecular weight of Dichlorodiphenoxymethane?
The molecular weight of Dichlorodiphenoxymethane is 269.12 g/mol.
What is the IUPAC name of Dichlorodiphenoxymethane?
The IUPAC name of Dichlorodiphenoxymethane is [dichloro(phenoxy)methoxy]benzene.
What is the InChI of Dichlorodiphenoxymethane?
The InChI of Dichlorodiphenoxymethane is InChI=1S/C13H10Cl2O2/c14-13(15,16-11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10H.
What is the InChIKey of Dichlorodiphenoxymethane?
The InChIKey of Dichlorodiphenoxymethane is TVIUSKXXXZSVJU-UHFFFAOYSA-N.
What is the Canonical SMILES of Dichlorodiphenoxymethane?
The Canonical SMILES of Dichlorodiphenoxymethane is C1=CC=C(C=C1)OC(OC2=CC=CC=C2)(Cl)Cl.
What is the CAS number of Dichlorodiphenoxymethane?
The CAS number of Dichlorodiphenoxymethane is 4885-03-4.
What is the European Community (EC) number of Dichlorodiphenoxymethane?
The European Community (EC) number of Dichlorodiphenoxymethane is 628-047-8.
What is the DSSTox Substance ID of Dichlorodiphenoxymethane?
The DSSTox Substance ID of Dichlorodiphenoxymethane is DTXSID80408505.
Is the compound canonicalized?
Yes, the compound Dichlorodiphenoxymethane is canonicalized.