What is the molecular formula of 2,5-Dimethylresorcinol?
The molecular formula of 2,5-Dimethylresorcinol is C8H10O2.
What is the molecular weight of 2,5-Dimethylresorcinol?
The molecular weight of 2,5-Dimethylresorcinol is 138.16 g/mol.
What is the IUPAC name of 2,5-Dimethylresorcinol?
The IUPAC name of 2,5-Dimethylresorcinol is 2,5-dimethylbenzene-1,3-diol.
What is the InChI of 2,5-Dimethylresorcinol?
The InChI of 2,5-Dimethylresorcinol is InChI=1S/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3.
What is the InChIKey of 2,5-Dimethylresorcinol?
The InChIKey of 2,5-Dimethylresorcinol is GHVHDYYKJYXFGU-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dimethylresorcinol?
The canonical SMILES of 2,5-Dimethylresorcinol is CC1=CC(=C(C(=C1)O)C)O.
What is the CAS number of 2,5-Dimethylresorcinol?
The CAS number of 2,5-Dimethylresorcinol is 488-87-9.
What is the European Community (EC) number of 2,5-Dimethylresorcinol?
The European Community (EC) number of 2,5-Dimethylresorcinol is 207-688-3.
What is the ChEMBL ID of 2,5-Dimethylresorcinol?
The ChEMBL ID of 2,5-Dimethylresorcinol is CHEMBL2332779.