The synonyms of the chemical are: 480436-46-2 2-(Butylthiocarbonothioylthio)propanoic acid 2-{[(Butylsulfanyl)carbonothioyl]sulfanyl}propanoic acid 2-{[(BUTYLSULFANYL)METHANETHIOYL]SULFANYL}PROPANOIC ACID 1671063-74-3
What is the molecular weight of the chemical?
The molecular weight is 238.4 g/mol.
When was the chemical created and modified?
The chemical was created on August 20, 2012, and last modified on October 21, 2023.
What is the IUPAC name of the chemical?
The IUPAC name of the chemical is 2-butylsulfanylcarbothioylsulfanylpropanoic acid.
What is the InChI of the chemical?
The InChI of the chemical is: InChI=1S/C8H14O2S3/c1-3-4-5-12-8(11)13-6(2)7(9)10/h6H,3-5H2,1-2H3,(H,9,10)
What is the InChIKey of the chemical?
The InChIKey of the chemical is VQUDUXBWOHBISV-UHFFFAOYSA-N.
What is the Canonical SMILES of the chemical?
The Canonical SMILES of the chemical is CCCCSC(=S)SC(C)C(=O)O.
What is the CAS number of the chemical?
The CAS number of the chemical is 480436-46-2.
What is the XLogP3-AA value of the chemical?
The XLogP3-AA value of the chemical is 3.4.
※ Please kindly note that our products are for research use only.