What is the molecular formula of 1-Hexen-3-ol?
The molecular formula of 1-Hexen-3-ol is C6H12O.
What is the molecular weight of 1-Hexen-3-ol?
The molecular weight of 1-Hexen-3-ol is 100.16 g/mol.
What is the IUPAC name of 1-Hexen-3-ol?
The IUPAC name of 1-Hexen-3-ol is hex-1-en-3-ol.
What is the InChI of 1-Hexen-3-ol?
The InChI of 1-Hexen-3-ol is InChI=1S/C6H12O/c1-3-5-6(7)4-2/h4,6-7H,2-3,5H2,1H3.
What is the InChIKey of 1-Hexen-3-ol?
The InChIKey of 1-Hexen-3-ol is BVOSSZSHBZQJOI-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Hexen-3-ol?
The canonical SMILES of 1-Hexen-3-ol is CCCC(C=C)O.
What is the CAS number of 1-Hexen-3-ol?
The CAS number of 1-Hexen-3-ol is 4798-44-1.
What is the FEMA number of 1-Hexen-3-ol?
The FEMA number of 1-Hexen-3-ol is 3608.
How many hydrogen bond donor counts does 1-Hexen-3-ol have?
1-Hexen-3-ol has 1 hydrogen bond donor count.
How many rotatable bond counts does 1-Hexen-3-ol have?
1-Hexen-3-ol has 3 rotatable bond counts.