What is the molecular formula of 2-Bromo-9,9-diphenylfluorene?
The molecular formula of 2-Bromo-9,9-diphenylfluorene is C25H17Br.
What is the molecular weight of 2-Bromo-9,9-diphenylfluorene?
The molecular weight of 2-Bromo-9,9-diphenylfluorene is 397.3 g/mol.
When was 2-Bromo-9,9-diphenylfluorene created?
2-Bromo-9,9-diphenylfluorene was created on September 1, 2010.
What is the InChI of 2-Bromo-9,9-diphenylfluorene?
The InChI of 2-Bromo-9,9-diphenylfluorene is InChI=1S/C25H17Br/c26-20-15-16-22-21-13-7-8-14-23(21)25(24(22)17-20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H.
What is the Canonical SMILES of 2-Bromo-9,9-diphenylfluorene?
The Canonical SMILES of 2-Bromo-9,9-diphenylfluorene is C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=C2C=C(C=C4)Br)C5=CC=CC=C5.
What is the CAS number of 2-Bromo-9,9-diphenylfluorene?
The CAS number of 2-Bromo-9,9-diphenylfluorene is 474918-32-6.
What is the XLogP3-AA value of 2-Bromo-9,9-diphenylfluorene?
The XLogP3-AA value of 2-Bromo-9,9-diphenylfluorene is 7.4.
How many rotatable bonds are present in 2-Bromo-9,9-diphenylfluorene?
There are 2 rotatable bonds present in 2-Bromo-9,9-diphenylfluorene.
What is the topological polar surface area of 2-Bromo-9,9-diphenylfluorene?
The topological polar surface area of 2-Bromo-9,9-diphenylfluorene is 0Ų.
Is 2-Bromo-9,9-diphenylfluorene a canonicalized compound?
Yes, 2-Bromo-9,9-diphenylfluorene is a canonicalized compound.
※ Please kindly note that our products are for research use only.