What is the molecular formula of 2-Phenylthiophene-5-boronic acid pinacol ester?
The molecular formula of 2-Phenylthiophene-5-boronic acid pinacol ester is C16H19BO2S.
What is the molecular weight of 2-Phenylthiophene-5-boronic acid pinacol ester?
The molecular weight of 2-Phenylthiophene-5-boronic acid pinacol ester is 286.2 g/mol.
What is the IUPAC name of 2-Phenylthiophene-5-boronic acid pinacol ester?
The IUPAC name of 2-Phenylthiophene-5-boronic acid pinacol ester is 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane.
What is the InChI of 2-Phenylthiophene-5-boronic acid pinacol ester?
The InChI of 2-Phenylthiophene-5-boronic acid pinacol ester is InChI=1S/C16H19BO2S/c1-15(2)16(3,4)19-17(18-15)14-11-10-13(20-14)12-8-6-5-7-9-12/h5-11H,1-4H3.
What is the InChIKey of 2-Phenylthiophene-5-boronic acid pinacol ester?
The InChIKey of 2-Phenylthiophene-5-boronic acid pinacol ester is BOTJOCNWKJVWRR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Phenylthiophene-5-boronic acid pinacol ester?
The canonical SMILES of 2-Phenylthiophene-5-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=CC=C3.
What is the CAS number of 2-Phenylthiophene-5-boronic acid pinacol ester?
The CAS number of 2-Phenylthiophene-5-boronic acid pinacol ester is 459409-74-6.
How many hydrogen bond donor counts does 2-Phenylthiophene-5-boronic acid pinacol ester have?
2-Phenylthiophene-5-boronic acid pinacol ester has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Phenylthiophene-5-boronic acid pinacol ester have?
2-Phenylthiophene-5-boronic acid pinacol ester has 3 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.