What is the molecular formula of 1-(3-Aminopropyl)-4-methylpiperazine?
The molecular formula of 1-(3-Aminopropyl)-4-methylpiperazine is C8H19N3.
What are the synonyms of 1-(3-Aminopropyl)-4-methylpiperazine?
The synonyms of 1-(3-Aminopropyl)-4-methylpiperazine are 4572-03-6, 3-(4-methylpiperazin-1-yl)propan-1-amine, 1-Piperazinepropanamine, 4-methyl-, and 3-(4-Methyl-piperazin-1-yl)-propylamine.
What is the molecular weight of 1-(3-Aminopropyl)-4-methylpiperazine?
The molecular weight of 1-(3-Aminopropyl)-4-methylpiperazine is 157.26 g/mol.
When was 1-(3-Aminopropyl)-4-methylpiperazine created and modified?
1-(3-Aminopropyl)-4-methylpiperazine was created on March 26, 2005, and modified on October 21, 2023.
What is the IUPAC name of 1-(3-Aminopropyl)-4-methylpiperazine?
The IUPAC name of 1-(3-Aminopropyl)-4-methylpiperazine is 3-(4-methylpiperazin-1-yl)propan-1-amine.
What is the InChI of 1-(3-Aminopropyl)-4-methylpiperazine?
The InChI of 1-(3-Aminopropyl)-4-methylpiperazine is InChI=1S/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3.
What is the InChIKey of 1-(3-Aminopropyl)-4-methylpiperazine?
The InChIKey of 1-(3-Aminopropyl)-4-methylpiperazine is RGUABPVONIGVAT-UHFFFAOYSA-N.
What is the canonical SMILES of 1-(3-Aminopropyl)-4-methylpiperazine?
The canonical SMILES of 1-(3-Aminopropyl)-4-methylpiperazine is CN1CCN(CC1)CCCN.
What is the CAS number of 1-(3-Aminopropyl)-4-methylpiperazine?
The CAS number of 1-(3-Aminopropyl)-4-methylpiperazine is 4572-03-6.
What is the XLogP3 value of 1-(3-Aminopropyl)-4-methylpiperazine?
The XLogP3 value of 1-(3-Aminopropyl)-4-methylpiperazine is -0.8.
※ Please kindly note that our products are for research use only.
Download
