What is the molecular formula of 3-Fluoroanisole?
The molecular formula of 3-Fluoroanisole is C7H7FO.
What is the molecular weight of 3-Fluoroanisole?
The molecular weight of 3-Fluoroanisole is 126.13 g/mol.
What is the IUPAC name of 3-Fluoroanisole?
The IUPAC name of 3-Fluoroanisole is 1-fluoro-3-methoxybenzene.
What is the InChI of 3-Fluoroanisole?
The InChI of 3-Fluoroanisole is InChI=1S/C7H7FO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3.
What is the InChIKey of 3-Fluoroanisole?
The InChIKey of 3-Fluoroanisole is MFJNOXOAIFNSBX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoroanisole?
The canonical SMILES of 3-Fluoroanisole is COC1=CC(=CC=C1)F.
What is the CAS number of 3-Fluoroanisole?
The CAS number of 3-Fluoroanisole is 456-49-5.
How many hydrogen bond donor counts does 3-Fluoroanisole have?
3-Fluoroanisole has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Fluoroanisole have?
3-Fluoroanisole has 2 hydrogen bond acceptor counts.
Download
