What is the molecular formula of 3-fluorobenzoic acid?
The molecular formula of 3-fluorobenzoic acid is C7H5FO2.
What is the molecular weight of 3-fluorobenzoic acid?
The molecular weight of 3-fluorobenzoic acid is 140.11 g/mol.
What is the IUPAC name of 3-fluorobenzoic acid?
The IUPAC name of 3-fluorobenzoic acid is 3-fluorobenzoic acid.
What is the InChI of 3-fluorobenzoic acid?
The InChI of 3-fluorobenzoic acid is InChI=1S/C7H5FO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10).
What is the InChIKey of 3-fluorobenzoic acid?
The InChIKey of 3-fluorobenzoic acid is MXNBDFWNYRNIBH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-fluorobenzoic acid?
The canonical SMILES of 3-fluorobenzoic acid is C1=CC(=CC(=C1)F)C(=O)O.
What is the CAS number of 3-fluorobenzoic acid?
The CAS number of 3-fluorobenzoic acid is 455-38-9.
What is the ChEMBL ID of 3-fluorobenzoic acid?
The ChEMBL ID of 3-fluorobenzoic acid is CHEMBL302365.
How many hydrogen bond donor counts does 3-fluorobenzoic acid have?
3-fluorobenzoic acid has 1 hydrogen bond donor count.
What is the topological polar surface area of 3-fluorobenzoic acid?
The topological polar surface area of 3-fluorobenzoic acid is 37.32.