What is the molecular formula of 2-Aminocarbazole?
The molecular formula of 2-Aminocarbazole is C12H10N2.
What are the synonyms for 2-Aminocarbazole?
The synonyms for 2-Aminocarbazole are 9H-Carbazol-2-amine, 4539-51-9, 222CW4U2Q4, and NSC-171107.
What is the molecular weight of 2-Aminocarbazole?
The molecular weight of 2-Aminocarbazole is 182.22 g/mol.
When was 2-Aminocarbazole created?
2-Aminocarbazole was created on March 26, 2005.
When was 2-Aminocarbazole last modified?
2-Aminocarbazole was last modified on October 21, 2023.
What is the IUPAC name of 2-Aminocarbazole?
The IUPAC name of 2-Aminocarbazole is 9H-carbazol-2-amine.
What is the InChI of 2-Aminocarbazole?
The InChI of 2-Aminocarbazole is InChI=1S/C12H10N2/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H,13H2.
What is the InChIKey of 2-Aminocarbazole?
The InChIKey of 2-Aminocarbazole is IGLKULAEHPBIJL-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Aminocarbazole?
The Canonical SMILES of 2-Aminocarbazole is C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)N.
What is the CAS number of 2-Aminocarbazole?
The CAS number of 2-Aminocarbazole is 4539-51-9.