What is the molecular formula of 4-Fluoro-3-iodotoluene?
The molecular formula of 4-Fluoro-3-iodotoluene is C7H6FI.
What is the molecular weight of 4-Fluoro-3-iodotoluene?
The molecular weight of 4-Fluoro-3-iodotoluene is 236.02 g/mol.
What is the IUPAC name of 4-Fluoro-3-iodotoluene?
The IUPAC name of 4-Fluoro-3-iodotoluene is 1-fluoro-2-iodo-4-methylbenzene.
What is the InChI of 4-Fluoro-3-iodotoluene?
The InChI of 4-Fluoro-3-iodotoluene is InChI=1S/C7H6FI/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3.
What is the InChIKey of 4-Fluoro-3-iodotoluene?
The InChIKey of 4-Fluoro-3-iodotoluene is XJWZEEGCMBQBNG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoro-3-iodotoluene?
The canonical SMILES of 4-Fluoro-3-iodotoluene is CC1=CC(=C(C=C1)F)I.
What is the CAS number of 4-Fluoro-3-iodotoluene?
The CAS number of 4-Fluoro-3-iodotoluene is 452-82-4.
What is the European Community (EC) number of 4-Fluoro-3-iodotoluene?
The European Community (EC) number of 4-Fluoro-3-iodotoluene is 624-168-5.
What is the DSSTox Substance ID of 4-Fluoro-3-iodotoluene?
The DSSTox Substance ID of 4-Fluoro-3-iodotoluene is DTXSID80282983.