What is the molecular formula of 4-Chloro-2-fluorotoluene?
The molecular formula of 4-Chloro-2-fluorotoluene is C7H6ClF.
What is the molecular weight or molar mass of 4-Chloro-2-fluorotoluene?
The molecular weight of 4-Chloro-2-fluorotoluene is 144.57 g/mol.
What is the IUPAC name of 4-Chloro-2-fluorotoluene?
The IUPAC name of 4-Chloro-2-fluorotoluene is 4-chloro-2-fluoro-1-methylbenzene.
What is the InChI of 4-Chloro-2-fluorotoluene?
The InChI of 4-Chloro-2-fluorotoluene is InChI=1S/C7H6ClF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3.
What is the InChIKey of 4-Chloro-2-fluorotoluene?
The InChIKey of 4-Chloro-2-fluorotoluene is MKFCYQTVSDCXAQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-2-fluorotoluene?
The canonical SMILES of 4-Chloro-2-fluorotoluene is CC1=C(C=C(C=C1)Cl)F.
What is the CAS number of 4-Chloro-2-fluorotoluene?
The CAS number of 4-Chloro-2-fluorotoluene is 452-75-5.
What is the European Community (EC) number of 4-Chloro-2-fluorotoluene?
The European Community (EC) number of 4-Chloro-2-fluorotoluene is 207-210-3.
What is the DSSTox Substance ID of 4-Chloro-2-fluorotoluene?
The DSSTox Substance ID of 4-Chloro-2-fluorotoluene is DTXSID10196428.
Is 4-Chloro-2-fluorotoluene a covalently-bonded unit?
Yes, 4-Chloro-2-fluorotoluene is a covalently-bonded unit with a count of 1.
Download
