What is the molecular formula of 1,2,3-butanetriol?
The molecular formula of 1,2,3-butanetriol is C4H10O3.
What is the molecular weight of 1,2,3-butanetriol?
The molecular weight of 1,2,3-butanetriol is 106.12 g/mol.
How is 1,2,3-butanetriol represented in IUPAC name?
1,2,3-butanetriol is represented as butane-1,2,3-triol in IUPAC name.
What is the InChI of 1,2,3-butanetriol?
The InChI of 1,2,3-butanetriol is InChI=1S/C4H10O3/c1-3(6)4(7)2-5/h3-7H,2H2,1H3.
What is the InChIKey of 1,2,3-butanetriol?
The InChIKey of 1,2,3-butanetriol is YAXKTBLXMTYWDQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1,2,3-butanetriol?
The canonical SMILES representation of 1,2,3-butanetriol is CC(C(CO)O)O.
What is the CAS number of 1,2,3-butanetriol?
The CAS number of 1,2,3-butanetriol is 4435-50-1.
What is the European Community (EC) number of 1,2,3-butanetriol?
The European Community (EC) number of 1,2,3-butanetriol is 224-643-3.
How many hydrogen bond donor count does 1,2,3-butanetriol have?
1,2,3-butanetriol has 3 hydrogen bond donor count.
How many hydrogen bond acceptor count does 1,2,3-butanetriol have?
1,2,3-butanetriol has 3 hydrogen bond acceptor count.