What is the molecular formula of Vat Violet 13?
The molecular formula of Vat Violet 13 is C28H14N2O4.
What is the molecular weight of Vat Violet 13?
The molecular weight of Vat Violet 13 is 442.4 g/mol.
What is the IUPAC name of Vat Violet 13?
The IUPAC name of Vat Violet 13 is 5,20-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-2,12,17,27-tetrone.
What is the InChI of Vat Violet 13?
The InChI of Vat Violet 13 is InChI=1S/C28H14N2O4/c31-25-13-5-1-3-7-19(13)29-23-17(25)11-9-15-21(23)27(33)16-10-12-18-24(22(16)28(15)34)30-20-8-4-2-6-14(20)26(18)32/h1-12H,(H,29,31)(H,30,32).
What is the InChIKey of Vat Violet 13?
The InChIKey of Vat Violet 13 is KLCBMAACUWYFIZ-UHFFFAOYSA-N.
What is the canonical SMILES of Vat Violet 13?
The canonical SMILES of Vat Violet 13 is C1=CC=C2C(=C1)C(=O)C3=C(N2)C4=C(C=C3)C(=O)C5=C(C4=O)C=CC6=C5NC7=CC=CC=C7C6=O.
What is the CAS number of Vat Violet 13?
The CAS number of Vat Violet 13 is 4424-87-7.
What is the molecular weight of Vat Violet 13 according to PubChem?
The molecular weight of Vat Violet 13 according to PubChem is 442.4 g/mol.
How many hydrogen bond donor counts does Vat Violet 13 have?
Vat Violet 13 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Vat Violet 13 have?
Vat Violet 13 has 6 hydrogen bond acceptor counts.