What is the molecular formula of Octafluorotoluene?
The molecular formula of Octafluorotoluene is C7F8.
What are some synonyms for Octafluorotoluene?
Some synonyms for Octafluorotoluene are Perfluorotoluene and 1,2,3,4,5-Pentafluoro-6-(trifluoromethyl)benzene.
What is the molecular weight of Octafluorotoluene?
The molecular weight of Octafluorotoluene is 236.06 g/mol.
When was Octafluorotoluene created?
Octafluorotoluene was created on March 26, 2005.
What is the IUPAC name of Octafluorotoluene?
The IUPAC name of Octafluorotoluene is 1,2,3,4,5-pentafluoro-6-(trifluoromethyl)benzene.
What is the InChI of Octafluorotoluene?
The InChI of Octafluorotoluene is InChI=1S/C7F8/c8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10.
What is the InChIKey of Octafluorotoluene?
The InChIKey of Octafluorotoluene is USPWUOFNOTUBAD-UHFFFAOYSA-N.
What is the canonical SMILES of Octafluorotoluene?
The canonical SMILES of Octafluorotoluene is C1(=C(C(=C(C(=C1F)F)F)F)F)C(F)(F)F.
What is the CAS number of Octafluorotoluene?
The CAS number of Octafluorotoluene is 434-64-0.
How many hydrogen bond acceptor counts does Octafluorotoluene have?
Octafluorotoluene has a hydrogen bond acceptor count of 8.
Download
