What is the molecular formula of 4-Methoxytriphenylamine?
The molecular formula of 4-Methoxytriphenylamine is C19H17NO.
What is the molecular weight of 4-Methoxytriphenylamine?
The molecular weight of 4-Methoxytriphenylamine is 275.3 g/mol.
What is the IUPAC name of 4-Methoxytriphenylamine?
The IUPAC name of 4-Methoxytriphenylamine is 4-methoxy-N,N-diphenylaniline.
What is the InChI of 4-Methoxytriphenylamine?
The InChI of 4-Methoxytriphenylamine is InChI=1S/C19H17NO/c1-21-19-14-12-18(13-15-19)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15H,1H3.
What is the InChIKey of 4-Methoxytriphenylamine?
The InChIKey of 4-Methoxytriphenylamine is KIGTXAWIOISJOG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methoxytriphenylamine?
The canonical SMILES of 4-Methoxytriphenylamine is COC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3.
What is the CAS number of 4-Methoxytriphenylamine?
The CAS number of 4-Methoxytriphenylamine is 4316-51-2.
What is the European Community (EC) number of 4-Methoxytriphenylamine?
The European Community (EC) number of 4-Methoxytriphenylamine is 627-427-0.
What is the DSSTox Substance ID of 4-Methoxytriphenylamine?
The DSSTox Substance ID of 4-Methoxytriphenylamine is DTXSID80432325.
Is 4-Methoxytriphenylamine a canonicalized compound?
Yes, 4-Methoxytriphenylamine is a canonicalized compound.
Download
