What is the molecular formula of 2-Bromo-5-ethoxypyridine?
The molecular formula of 2-Bromo-5-ethoxypyridine is C7H8BrNO.
What is the molecular weight of 2-Bromo-5-ethoxypyridine?
The molecular weight of 2-Bromo-5-ethoxypyridine is 202.05 g/mol.
What is the IUPAC name of 2-Bromo-5-ethoxypyridine?
The IUPAC name of 2-Bromo-5-ethoxypyridine is 2-bromo-5-ethoxypyridine.
What is the InChI of 2-Bromo-5-ethoxypyridine?
The InChI of 2-Bromo-5-ethoxypyridine is InChI=1S/C7H8BrNO/c1-2-10-6-3-4-7(8)9-5-6/h3-5H,2H2,1H3.
What is the InChIKey of 2-Bromo-5-ethoxypyridine?
The InChIKey of 2-Bromo-5-ethoxypyridine is RXVSMILQHDQEDM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-ethoxypyridine?
The canonical SMILES of 2-Bromo-5-ethoxypyridine is CCOC1=CN=C(C=C1)Br.
What is the CAS number of 2-Bromo-5-ethoxypyridine?
The CAS number of 2-Bromo-5-ethoxypyridine is 42834-01-5.
How many hydrogen bond acceptor count does 2-Bromo-5-ethoxypyridine have?
2-Bromo-5-ethoxypyridine has 2 hydrogen bond acceptor count.
How many rotatable bond count does 2-Bromo-5-ethoxypyridine have?
2-Bromo-5-ethoxypyridine has 2 rotatable bond count.
Download
![Ethyl 3-bromoimidazo[1,2-a]pyridine-5-carboxylate](https://resource.alfa-chemistry.com/structure/429690-42-6.gif)
